C7H6N7O2+ — CID 45040778
8-azido-1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 45040778) has the molecular formula C7H6N7O2+ and a molecular weight of 220.17 g/mol. Its IUPAC name is 8-azido-1,3-dimethylpurin-3-ium-2,6-dione.
| Compound Name | 8-azido-1,3-dimethylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 45040778 |
| Molecular Formula | C7H6N7O2+ |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 8-azido-1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CN1C(=O)C2=NC(N=[N+]=[N-])=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C7H6N7O2/c1-13-4-3(5(15)14(2)7(13)16)9-6(10-4)11-12-8/h1-2H3/q+1 |
| InChIKey | BBCHGPVTINVULJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 113.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|