C26H40BrNO — CID 45048366
1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium bromide (PubChem CID 45048366) has the molecular formula C26H40BrNO and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium bromide.
| Compound Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 45048366 |
| Molecular Formula | C26H40BrNO |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium bromide |
| SMILES | CCCCCc1ccc(OCCCC[n+]2cccc(C)c2)c(CCCCC)c1.[Br-] |
| InChI | InChI=1S/C26H40NO.BrH/c1-4-6-8-14-24-16-17-26(25(21-24)15-9-7-5-2)28-20-11-10-18-27-19-12-13-23(3)22-27;/h12-13,16-17,19,21-22H,4-11,14-15,18,20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FFGRJTQZPFNQLB-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|