C28H44BrNO — CID 45046319
1-[4-(2,4-dipentylphenoxy)butyl]-5-ethyl-2-methylpyridin-1-ium bromide (PubChem CID 45046319) has the molecular formula C28H44BrNO and a molecular weight of 490.57 g/mol. Its IUPAC name is 1-[4-(2,4-dipentylphenoxy)butyl]-5-ethyl-2-methylpyridin-1-ium bromide.
| Compound Name | 1-[4-(2,4-dipentylphenoxy)butyl]-5-ethyl-2-methylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 45046319 |
| Molecular Formula | C28H44BrNO |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 1-[4-(2,4-dipentylphenoxy)butyl]-5-ethyl-2-methylpyridin-1-ium bromide |
| SMILES | CCCCCc1ccc(OCCCC[n+]2cc(CC)ccc2C)c(CCCCC)c1.[Br-] |
| InChI | InChI=1S/C28H44NO.BrH/c1-5-8-10-14-26-18-19-28(27(22-26)15-11-9-6-2)30-21-13-12-20-29-23-25(7-3)17-16-24(29)4;/h16-19,22-23H,5-15,20-21H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GAEMHMPGJQJMSO-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|