C28H42ClN2O+ — CID 126959089
1-[4-(2,4-dipentylphenoxy)butyl]-3-methylbenzimidazol-3-ium;hydrochloride (PubChem CID 126959089) has the molecular formula C28H42ClN2O+ and a molecular weight of 458.11 g/mol. Its IUPAC name is 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylbenzimidazol-3-ium;hydrochloride.
| Compound Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylbenzimidazol-3-ium;hydrochloride |
|---|---|
| PubChem CID | 126959089 |
| Molecular Formula | C28H42ClN2O+ |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylbenzimidazol-3-ium;hydrochloride |
| SMILES | CCCCCc1ccc(OCCCCn2c[n+](C)c3ccccc32)c(CCCCC)c1.Cl |
| InChI | InChI=1S/C28H41N2O.ClH/c1-4-6-8-14-24-18-19-28(25(22-24)15-9-7-5-2)31-21-13-12-20-30-23-29(3)26-16-10-11-17-27(26)30;/h10-11,16-19,22-23H,4-9,12-15,20-21H2,1-3H3;1H/q+1; |
| InChIKey | SOOMXQHDOGKCTG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|