C28H26N2O3S — CID 45049586
N,N-dibenzyl-1-phenylmethanamine;1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 45049586) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is N,N-dibenzyl-1-phenylmethanamine;1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | N,N-dibenzyl-1-phenylmethanamine;1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 45049586 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N,N-dibenzyl-1-phenylmethanamine;1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)(=O)c2ccccc21.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N.C7H5NO3S/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;9-7-5-3-1-2-4-6(5)12(10,11)8-7/h1-15H,16-18H2;1-4H,(H,8,9) |
| InChIKey | RVNHHEOWEXRNKZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |