C4H8N4O — CID 45078795
4-amino-6-methyl-5,6-dihydro-1,2,4-triazin-3-one (PubChem CID 45078795) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-amino-6-methyl-5,6-dihydro-1,2,4-triazin-3-one.
| Compound Name | 4-amino-6-methyl-5,6-dihydro-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 45078795 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 4-amino-6-methyl-5,6-dihydro-1,2,4-triazin-3-one |
| SMILES | CC1CN(N)C(=O)N=N1 |
| InChI | InChI=1S/C4H8N4O/c1-3-2-8(5)4(9)7-6-3/h3H,2,5H2,1H3 |
| InChIKey | VHBHLLKFYUXYOK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|