C16H26N3O10PS — CID 45101460
S-[2-[[(2R,3S,4S,5S)-5-(4-amino-2-oxo-1H-pyrimidin-6-yl)-3,4-dihydroxyoxolan-2-yl]methylperoxy-hydroxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 45101460) has the molecular formula C16H26N3O10PS and a molecular weight of 483.44 g/mol. Its IUPAC name is S-[2-[[(2R,3S,4S,5S)-5-(4-amino-2-oxo-1H-pyrimidin-6-yl)-3,4-dihydroxyoxolan-2-yl]methylperoxy-hydroxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3S,4S,5S)-5-(4-amino-2-oxo-1H-pyrimidin-6-yl)-3,4-dihydroxyoxolan-2-yl]methylperoxy-hydroxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 45101460 |
| Molecular Formula | C16H26N3O10PS |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | S-[2-[[(2R,3S,4S,5S)-5-(4-amino-2-oxo-1H-pyrimidin-6-yl)-3,4-dihydroxyoxolan-2-yl]methylperoxy-hydroxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(O)OOC[C@H]1O[C@@H](c2cc(N)nc(=O)[nH]2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H26N3O10PS/c1-16(2,3)14(22)31-5-4-27-30(24,25)29-26-7-9-11(20)12(21)13(28-9)8-6-10(17)19-15(23)18-8/h6,9,11-13,20-21H,4-5,7H2,1-3H3,(H,24,25)(H3,17,18,19,23)/t9-,11-,12+,13+/m1/s1 |
| InChIKey | KOCOOCPSWDRXQJ-XEZLXBQYSA-N |
| XLogP | -0.12 |
| TPSA | 203.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|