C22H28N2O2 — CID 45109035
[(2Z)-3,7-dimethylocta-2,6-dienyl] 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 45109035) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 45109035 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C22H28N2O2/c1-16(2)7-6-8-17(3)12-14-26-22(25)24-13-11-19-18-9-4-5-10-20(18)23-21(19)15-24/h4-5,7,9-10,12,23H,6,8,11,13-15H2,1-3H3/b17-12- |
| InChIKey | ZKGYBAZNGYWOLI-ATVHPVEESA-N |
| XLogP | 5.36 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|