C22H20N4O7 — CID 45118880
[2-acetyloxy-3-[(4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)carbamoyl]phenyl] acetate (PubChem CID 45118880) has the molecular formula C22H20N4O7 and a molecular weight of 452.42 g/mol. Its IUPAC name is [2-acetyloxy-3-[(4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-3-[(4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 45118880 |
| Molecular Formula | C22H20N4O7 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [2-acetyloxy-3-[(4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2c(N)n(-c3ccccc3)c(=O)n(C)c2=O)c1OC(C)=O |
| InChI | InChI=1S/C22H20N4O7/c1-12(27)32-16-11-7-10-15(18(16)33-13(2)28)20(29)24-17-19(23)26(14-8-5-4-6-9-14)22(31)25(3)21(17)30/h4-11H,23H2,1-3H3,(H,24,29) |
| InChIKey | ITHAPGDWQVPGSD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|