C21H30O5 — CID 45142365
2-[(2R,3S,6R)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-phenylmethoxyoxan-2-yl]acetic acid (PubChem CID 45142365) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-phenylmethoxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S,6R)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-phenylmethoxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 45142365 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[(2R,3S,6R)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-phenylmethoxyoxan-2-yl]acetic acid |
| SMILES | C[C@H](O)CCC/C=C/[C@H]1CC[C@H](OCc2ccccc2)[C@@H](CC(=O)O)O1 |
| InChI | InChI=1S/C21H30O5/c1-16(22)8-4-2-7-11-18-12-13-19(20(26-18)14-21(23)24)25-15-17-9-5-3-6-10-17/h3,5-7,9-11,16,18-20,22H,2,4,8,12-15H2,1H3,(H,23,24)/b11-7+/t16-,18-,19-,20+/m0/s1 |
| InChIKey | OVRWKSYPJHULMI-GYKLAMFSSA-N |
| XLogP | 3.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|