C10H13Cl3N2O — CID 45264353
2-(2,4-dichlorophenoxy)-N,N'-dimethylethanimidamide;hydrochloride (PubChem CID 45264353) has the molecular formula C10H13Cl3N2O and a molecular weight of 283.59 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N,N'-dimethylethanimidamide;hydrochloride.
| Compound Name | 2-(2,4-dichlorophenoxy)-N,N'-dimethylethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 45264353 |
| Molecular Formula | C10H13Cl3N2O |
| Molecular Weight | 283.59 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N,N'-dimethylethanimidamide;hydrochloride |
| SMILES | C/N=C(/COc1ccc(Cl)cc1Cl)NC.Cl |
| InChI | InChI=1S/C10H12Cl2N2O.ClH/c1-13-10(14-2)6-15-9-4-3-7(11)5-8(9)12;/h3-5H,6H2,1-2H3,(H,13,14);1H |
| InChIKey | UQZTWPSBKOSPQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|