C16H16ClN3O2S2 — CID 45276651
5-tert-butyl-3-(6-chloro-2-prop-2-enylsulfanyl-1,3-benzothiazol-5-yl)-1,3,4-oxadiazol-2-one (PubChem CID 45276651) has the molecular formula C16H16ClN3O2S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is 5-tert-butyl-3-(6-chloro-2-prop-2-enylsulfanyl-1,3-benzothiazol-5-yl)-1,3,4-oxadiazol-2-one.
| Compound Name | 5-tert-butyl-3-(6-chloro-2-prop-2-enylsulfanyl-1,3-benzothiazol-5-yl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 45276651 |
| Molecular Formula | C16H16ClN3O2S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 5-tert-butyl-3-(6-chloro-2-prop-2-enylsulfanyl-1,3-benzothiazol-5-yl)-1,3,4-oxadiazol-2-one |
| SMILES | C=CCSc1nc2cc(-n3nc(C(C)(C)C)oc3=O)c(Cl)cc2s1 |
| InChI | InChI=1S/C16H16ClN3O2S2/c1-5-6-23-14-18-10-8-11(9(17)7-12(10)24-14)20-15(21)22-13(19-20)16(2,3)4/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | WJOPEUUFXOPDOL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|