C25H29ClN4OS — CID 4539621
N-benzyl-2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide (PubChem CID 4539621) has the molecular formula C25H29ClN4OS and a molecular weight of 469.05 g/mol. Its IUPAC name is N-benzyl-2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide.
| Compound Name | N-benzyl-2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4539621 |
| Molecular Formula | C25H29ClN4OS |
| Molecular Weight | 469.05 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-benzyl-2-[4-chloro-6-(diethylamino)pyrimidin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
| SMILES | CCN(CC)c1cc(Cl)nc(SCC(=O)N(CCc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H29ClN4OS/c1-3-29(4-2)23-17-22(26)27-25(28-23)32-19-24(31)30(18-21-13-9-6-10-14-21)16-15-20-11-7-5-8-12-20/h5-14,17H,3-4,15-16,18-19H2,1-2H3 |
| InChIKey | JBTHSQBGGLNPDN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.05 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |