C26H15Cl4NO — CID 4543627
3-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-naphthalen-2-ylprop-2-enenitrile (PubChem CID 4543627) has the molecular formula C26H15Cl4NO and a molecular weight of 499.22 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-naphthalen-2-ylprop-2-enenitrile.
| Compound Name | 3-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-naphthalen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 4543627 |
| Molecular Formula | C26H15Cl4NO |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | 3-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-naphthalen-2-ylprop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Cl)c(OCc2ccc(Cl)c(Cl)c2)c(Cl)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H15Cl4NO/c27-22-8-5-16(10-23(22)28)15-32-26-24(29)11-17(12-25(26)30)9-21(14-31)20-7-6-18-3-1-2-4-19(18)13-20/h1-13H,15H2 |
| InChIKey | WKTWRNUAYYRJSE-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|