C19H14Cl3N3O2S2 — CID 4551980
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4551980) has the molecular formula C19H14Cl3N3O2S2 and a molecular weight of 486.83 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4551980 |
| Molecular Formula | C19H14Cl3N3O2S2 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H14Cl3N3O2S2/c1-10(27-16-7-6-13(21)8-14(16)22)17(26)24-18(28)25-19-23-15(9-29-19)11-2-4-12(20)5-3-11/h2-10H,1H3,(H2,23,24,25,26,28) |
| InChIKey | QSUQSGLUJHFRRF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|