C35H29Cl2NO8 — CID 4586536
5-[4-chloro-2-(2-chlorobenzoyl)anilino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 4586536) has the molecular formula C35H29Cl2NO8 and a molecular weight of 662.52 g/mol. Its IUPAC name is 5-[4-chloro-2-(2-chlorobenzoyl)anilino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | 5-[4-chloro-2-(2-chlorobenzoyl)anilino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 4586536 |
| Molecular Formula | C35H29Cl2NO8 |
| Molecular Weight | 662.52 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 5-[4-chloro-2-(2-chlorobenzoyl)anilino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc(C2c3cc4c(cc3C(Nc3ccc(Cl)cc3C(=O)c3ccccc3Cl)C3COC(=O)C23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C35H29Cl2NO8/c1-41-28-10-17(11-29(42-2)34(28)43-3)30-20-13-26-27(46-16-45-26)14-21(20)32(23-15-44-35(40)31(23)30)38-25-9-8-18(36)12-22(25)33(39)19-6-4-5-7-24(19)37/h4-14,23,30-32,38H,15-16H2,1-3H3 |
| InChIKey | JPTYRQOYOGPYKK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.52 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|