C26H18N2O4 — CID 4586957
7-(furan-2-ylmethylamino)-1-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione (PubChem CID 4586957) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 7-(furan-2-ylmethylamino)-1-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione.
| Compound Name | 7-(furan-2-ylmethylamino)-1-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
|---|---|
| PubChem CID | 4586957 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 7-(furan-2-ylmethylamino)-1-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
| SMILES | Cc1cccc2oc3cc(NCc4ccco4)c4c(=O)c5ccccc5c(=O)c4c3[nH]c12 |
| InChI | InChI=1S/C26H18N2O4/c1-14-6-4-10-19-23(14)28-24-20(32-19)12-18(27-13-15-7-5-11-31-15)21-22(24)26(30)17-9-3-2-8-16(17)25(21)29/h2-12,27-28H,13H2,1H3 |
| InChIKey | XQCCCJMTPKMRRN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|