C21H12ClNO6S — CID 56630321
7-hydroxy-2-methyl-8,13-dioxo-14H-naphtho[2,3-a]phenoxazine-3-sulfonyl chloride (PubChem CID 56630321) has the molecular formula C21H12ClNO6S and a molecular weight of 441.85 g/mol. Its IUPAC name is 7-hydroxy-2-methyl-8,13-dioxo-14H-naphtho[2,3-a]phenoxazine-3-sulfonyl chloride.
| Compound Name | 7-hydroxy-2-methyl-8,13-dioxo-14H-naphtho[2,3-a]phenoxazine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 56630321 |
| Molecular Formula | C21H12ClNO6S |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 7-hydroxy-2-methyl-8,13-dioxo-14H-naphtho[2,3-a]phenoxazine-3-sulfonyl chloride |
| SMILES | Cc1cc2[nH]c3c(cc(O)c4c(=O)c5ccccc5c(=O)c43)oc2cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C21H12ClNO6S/c1-9-6-12-14(8-16(9)30(22,27)28)29-15-7-13(24)17-18(19(15)23-12)21(26)11-5-3-2-4-10(11)20(17)25/h2-8,23-24H,1H3 |
| InChIKey | JOULVHAAOXREJZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|