C29H20N2O4 — CID 101061344
2-acetyl-7-(4-methylanilino)-14H-naphtho[3,2-a]phenoxazine-8,13-dione (PubChem CID 101061344) has the molecular formula C29H20N2O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-acetyl-7-(4-methylanilino)-14H-naphtho[3,2-a]phenoxazine-8,13-dione.
| Compound Name | 2-acetyl-7-(4-methylanilino)-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
|---|---|
| PubChem CID | 101061344 |
| Molecular Formula | C29H20N2O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-acetyl-7-(4-methylanilino)-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
| SMILES | CC(=O)c1ccc2oc3cc(Nc4ccc(C)cc4)c4c(=O)c5ccccc5c(=O)c4c3[nH]c2c1 |
| InChI | InChI=1S/C29H20N2O4/c1-15-7-10-18(11-8-15)30-22-14-24-27(31-21-13-17(16(2)32)9-12-23(21)35-24)26-25(22)28(33)19-5-3-4-6-20(19)29(26)34/h3-14,30-31H,1-2H3 |
| InChIKey | OFOWBCNETXUJTQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|