C22H17BrN2O2S — CID 4595705
5-bromo-3-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-1-benzofuran-2-carboxamide (PubChem CID 4595705) has the molecular formula C22H17BrN2O2S and a molecular weight of 453.36 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4595705 |
| Molecular Formula | C22H17BrN2O2S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 5-bromo-3-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-1-benzofuran-2-carboxamide |
| SMILES | C=CCN(C(=O)c1oc2ccc(Br)cc2c1C)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H17BrN2O2S/c1-3-11-25(22-24-18(13-28-22)15-7-5-4-6-8-15)21(26)20-14(2)17-12-16(23)9-10-19(17)27-20/h3-10,12-13H,1,11H2,2H3 |
| InChIKey | BNCVYNNGJZARIU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|