C18H26N2O3 — CID 4601585
2-methylpropyl N-(2-methylbenzoyl)-N'-(oxolan-2-ylmethyl)carbamimidate (PubChem CID 4601585) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-methylpropyl N-(2-methylbenzoyl)-N'-(oxolan-2-ylmethyl)carbamimidate.
| Compound Name | 2-methylpropyl N-(2-methylbenzoyl)-N'-(oxolan-2-ylmethyl)carbamimidate |
|---|---|
| PubChem CID | 4601585 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-methylpropyl N-(2-methylbenzoyl)-N'-(oxolan-2-ylmethyl)carbamimidate |
| SMILES | Cc1ccccc1C(=O)N/C(=N/CC1CCCO1)OCC(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)12-23-18(19-11-15-8-6-10-22-15)20-17(21)16-9-5-4-7-14(16)3/h4-5,7,9,13,15H,6,8,10-12H2,1-3H3,(H,19,20,21) |
| InChIKey | NRNJTHLTZXNIOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|