C28H35N4O3+ — CID 4601749
8-(4-tert-butylphenoxy)-7-[(4-tert-butylphenyl)methyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione (PubChem CID 4601749) has the molecular formula C28H35N4O3+ and a molecular weight of 475.61 g/mol. Its IUPAC name is 8-(4-tert-butylphenoxy)-7-[(4-tert-butylphenyl)methyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione.
| Compound Name | 8-(4-tert-butylphenoxy)-7-[(4-tert-butylphenyl)methyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 4601749 |
| Molecular Formula | C28H35N4O3+ |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 8-(4-tert-butylphenoxy)-7-[(4-tert-butylphenyl)methyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione |
| SMILES | Cn1c(=O)c2c([nH]c(Oc3ccc(C(C)(C)C)cc3)[n+]2Cc2ccc(C(C)(C)C)cc2)n(C)c1=O |
| InChI | InChI=1S/C28H34N4O3/c1-27(2,3)19-11-9-18(10-12-19)17-32-22-23(30(7)26(34)31(8)24(22)33)29-25(32)35-21-15-13-20(14-16-21)28(4,5)6/h9-16H,17H2,1-8H3/p+1 |
| InChIKey | OYMJFGWTPPOPKQ-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 72.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|