C26H35N3O3 — CID 46097620
ethyl 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5-(4-ethylphenyl)pyrazole-3-carboxylate (PubChem CID 46097620) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is ethyl 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5-(4-ethylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5-(4-ethylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46097620 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | ethyl 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5-(4-ethylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(CC)cc2)n(C2CCN(C(=O)C3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C26H35N3O3/c1-3-19-10-12-20(13-11-19)24-18-23(26(31)32-4-2)27-29(24)22-14-16-28(17-15-22)25(30)21-8-6-5-7-9-21/h10-13,18,21-22H,3-9,14-17H2,1-2H3 |
| InChIKey | HZESBXVBGSLYNO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |