C30H39NO5 — CID 46102491
ethyl 2-[4-[(4-heptoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(3-methoxyphenyl)acetate (PubChem CID 46102491) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is ethyl 2-[4-[(4-heptoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(3-methoxyphenyl)acetate.
| Compound Name | ethyl 2-[4-[(4-heptoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 46102491 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | ethyl 2-[4-[(4-heptoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(3-methoxyphenyl)acetate |
| SMILES | CCCCCCCOc1ccc(C(=O)NC2C=CC(C(C(=O)OCC)c3cccc(OC)c3)C2)cc1 |
| InChI | InChI=1S/C30H39NO5/c1-4-6-7-8-9-19-36-26-17-14-22(15-18-26)29(32)31-25-16-13-24(20-25)28(30(33)35-5-2)23-11-10-12-27(21-23)34-3/h10-18,21,24-25,28H,4-9,19-20H2,1-3H3,(H,31,32) |
| InChIKey | UUVVLUZZEZAPOC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|