C28H29NO5 — CID 93310104
ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-(naphthalene-2-carbonylamino)cyclopent-2-en-1-yl]acetate (PubChem CID 93310104) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-(naphthalene-2-carbonylamino)cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-(naphthalene-2-carbonylamino)cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 93310104 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-(naphthalene-2-carbonylamino)cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)[C@H](c1cc(OC)ccc1OC)[C@H]1C=C[C@@H](NC(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H29NO5/c1-4-34-28(31)26(24-17-23(32-2)13-14-25(24)33-3)20-11-12-22(16-20)29-27(30)21-10-9-18-7-5-6-8-19(18)15-21/h5-15,17,20,22,26H,4,16H2,1-3H3,(H,29,30)/t20-,22+,26-/m0/s1 |
| InChIKey | OECFWRWBKMARAD-HXAGEGRHSA-N |
| XLogP | 4.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|