C24H25F2NO5 — CID 46082530
ethyl 2-[4-[(3,5-difluorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,4-dimethoxyphenyl)acetate (PubChem CID 46082530) has the molecular formula C24H25F2NO5 and a molecular weight of 445.46 g/mol. Its IUPAC name is ethyl 2-[4-[(3,5-difluorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | ethyl 2-[4-[(3,5-difluorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 46082530 |
| Molecular Formula | C24H25F2NO5 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | ethyl 2-[4-[(3,5-difluorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,4-dimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(OC)c(OC)c1)C1C=CC(NC(=O)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C24H25F2NO5/c1-4-32-24(29)22(15-6-8-20(30-2)21(12-15)31-3)14-5-7-19(11-14)27-23(28)16-9-17(25)13-18(26)10-16/h5-10,12-14,19,22H,4,11H2,1-3H3,(H,27,28) |
| InChIKey | HVARHDAWKQCAGC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|