C24H26F3NO7S — CID 46102503
ethyl 2-(3,4-dimethoxyphenyl)-2-[4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]cyclopent-2-en-1-yl]acetate (PubChem CID 46102503) has the molecular formula C24H26F3NO7S and a molecular weight of 529.53 g/mol. Its IUPAC name is ethyl 2-(3,4-dimethoxyphenyl)-2-[4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl 2-(3,4-dimethoxyphenyl)-2-[4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 46102503 |
| Molecular Formula | C24H26F3NO7S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | ethyl 2-(3,4-dimethoxyphenyl)-2-[4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C(c1ccc(OC)c(OC)c1)C1C=CC(NS(=O)(=O)c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C24H26F3NO7S/c1-4-34-23(29)22(16-10-12-18(32-2)20(14-16)33-3)15-9-11-17(13-15)28-36(30,31)21-8-6-5-7-19(21)35-24(25,26)27/h5-12,14-15,17,22,28H,4,13H2,1-3H3 |
| InChIKey | WBWFWDQLXRVUDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|