C25H26F3NO4 — CID 92762035
ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4R)-4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate (PubChem CID 92762035) has the molecular formula C25H26F3NO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4R)-4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4R)-4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 92762035 |
| Molecular Formula | C25H26F3NO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4R)-4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)[C@H](c1cc(C)cc(C)c1)[C@@H]1C=C[C@H](NC(=O)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H26F3NO4/c1-4-32-24(31)22(19-11-15(2)10-16(3)12-19)17-8-9-20(13-17)29-23(30)18-6-5-7-21(14-18)33-25(26,27)28/h5-12,14,17,20,22H,4,13H2,1-3H3,(H,29,30)/t17-,20+,22+/m1/s1 |
| InChIKey | YEWXZOLEGGLHNW-AGHHOFFYSA-N |
| XLogP | 5.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|