C28H35NO4 — CID 92761316
ethyl (2R)-2-(3-methoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 92761316) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is ethyl (2R)-2-(3-methoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2R)-2-(3-methoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 92761316 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | ethyl (2R)-2-(3-methoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCCCCc1ccc(C(=O)N[C@@H]2C=C[C@H]([C@@H](C(=O)OCC)c3cccc(OC)c3)C2)cc1 |
| InChI | InChI=1S/C28H35NO4/c1-4-6-7-9-20-12-14-21(15-13-20)27(30)29-24-17-16-23(18-24)26(28(31)33-5-2)22-10-8-11-25(19-22)32-3/h8,10-17,19,23-24,26H,4-7,9,18H2,1-3H3,(H,29,30)/t23-,24+,26-/m0/s1 |
| InChIKey | OEEMFGIAEYPUOQ-GSLIJJQTSA-N |
| XLogP | 5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|