C25H26F3NO6 — CID 46102376
ethyl 2-(2,5-dimethoxyphenyl)-2-[4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate (PubChem CID 46102376) has the molecular formula C25H26F3NO6 and a molecular weight of 493.48 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethoxyphenyl)-2-[4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl 2-(2,5-dimethoxyphenyl)-2-[4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 46102376 |
| Molecular Formula | C25H26F3NO6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | ethyl 2-(2,5-dimethoxyphenyl)-2-[4-[[3-(trifluoromethoxy)benzoyl]amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C(c1cc(OC)ccc1OC)C1C=CC(NC(=O)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H26F3NO6/c1-4-34-24(31)22(20-14-18(32-2)10-11-21(20)33-3)15-8-9-17(12-15)29-23(30)16-6-5-7-19(13-16)35-25(26,27)28/h5-11,13-15,17,22H,4,12H2,1-3H3,(H,29,30) |
| InChIKey | UOMJKKNQMPXZBT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|