C23H24FNO4 — CID 71958472
methyl 2-[4-[(2-ethoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate (PubChem CID 71958472) has the molecular formula C23H24FNO4 and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 2-[4-[(2-ethoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate.
| Compound Name | methyl 2-[4-[(2-ethoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 71958472 |
| Molecular Formula | C23H24FNO4 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl 2-[4-[(2-ethoxybenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
| SMILES | CCOc1ccccc1C(=O)NC1C=CC(C(C(=O)OC)c2ccccc2F)C1 |
| InChI | InChI=1S/C23H24FNO4/c1-3-29-20-11-7-5-9-18(20)22(26)25-16-13-12-15(14-16)21(23(27)28-2)17-8-4-6-10-19(17)24/h4-13,15-16,21H,3,14H2,1-2H3,(H,25,26) |
| InChIKey | AOBKZYKDJHFHRZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|