C19H17ClFNO3S — CID 46102406
methyl 2-[4-[(3-chlorothiophene-2-carbonyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate (PubChem CID 46102406) has the molecular formula C19H17ClFNO3S and a molecular weight of 393.87 g/mol. Its IUPAC name is methyl 2-[4-[(3-chlorothiophene-2-carbonyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate.
| Compound Name | methyl 2-[4-[(3-chlorothiophene-2-carbonyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 46102406 |
| Molecular Formula | C19H17ClFNO3S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl 2-[4-[(3-chlorothiophene-2-carbonyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
| SMILES | COC(=O)C(c1ccccc1F)C1C=CC(NC(=O)c2sccc2Cl)C1 |
| InChI | InChI=1S/C19H17ClFNO3S/c1-25-19(24)16(13-4-2-3-5-15(13)21)11-6-7-12(10-11)22-18(23)17-14(20)8-9-26-17/h2-9,11-12,16H,10H2,1H3,(H,22,23) |
| InChIKey | LPEBWQHSJOYTIP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|