C22H21Cl2NO4 — CID 93295609
methyl (2S)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(4-methoxyphenyl)acetate (PubChem CID 93295609) has the molecular formula C22H21Cl2NO4 and a molecular weight of 434.32 g/mol. Its IUPAC name is methyl (2S)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(4-methoxyphenyl)acetate.
| Compound Name | methyl (2S)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 93295609 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | methyl (2S)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(4-methoxyphenyl)acetate |
| SMILES | COC(=O)[C@H](c1ccc(OC)cc1)[C@H]1C=C[C@@H](NC(=O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C22H21Cl2NO4/c1-28-19-7-4-13(5-8-19)20(22(27)29-2)14-3-6-18(11-14)25-21(26)15-9-16(23)12-17(24)10-15/h3-10,12,14,18,20H,11H2,1-2H3,(H,25,26)/t14-,18+,20+/m0/s1 |
| InChIKey | IBTLBXPTDZXHIU-BOUXLOLZSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|