C21H14ClF6NO3 — CID 46082366
methyl 2-(2-chloro-4-fluorophenyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 46082366) has the molecular formula C21H14ClF6NO3 and a molecular weight of 477.79 g/mol. Its IUPAC name is methyl 2-(2-chloro-4-fluorophenyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-(2-chloro-4-fluorophenyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 46082366 |
| Molecular Formula | C21H14ClF6NO3 |
| Molecular Weight | 477.79 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | methyl 2-(2-chloro-4-fluorophenyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)C(c1ccc(F)cc1Cl)C1C=CC(NC(=O)c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C21H14ClF6NO3/c1-32-21(31)13(11-5-3-9(23)7-12(11)22)8-2-4-10(6-8)29-20(30)14-15(24)17(26)19(28)18(27)16(14)25/h2-5,7-8,10,13H,6H2,1H3,(H,29,30) |
| InChIKey | YVTAHRZZPGJCPK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|