C21H17F4NO3 — CID 46102407
methyl 2-(2-fluorophenyl)-2-[4-[(2,4,6-trifluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 46102407) has the molecular formula C21H17F4NO3 and a molecular weight of 407.36 g/mol. Its IUPAC name is methyl 2-(2-fluorophenyl)-2-[4-[(2,4,6-trifluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-(2-fluorophenyl)-2-[4-[(2,4,6-trifluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 46102407 |
| Molecular Formula | C21H17F4NO3 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | methyl 2-(2-fluorophenyl)-2-[4-[(2,4,6-trifluorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1F)C1C=CC(NC(=O)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C21H17F4NO3/c1-29-21(28)18(14-4-2-3-5-15(14)23)11-6-7-13(8-11)26-20(27)19-16(24)9-12(22)10-17(19)25/h2-7,9-11,13,18H,8H2,1H3,(H,26,27) |
| InChIKey | RHCZJUISQVBLKN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|