C21H18Cl2FNO3 — CID 93295589
methyl (2S)-2-[(1S,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate (PubChem CID 93295589) has the molecular formula C21H18Cl2FNO3 and a molecular weight of 422.28 g/mol. Its IUPAC name is methyl (2S)-2-[(1S,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate.
| Compound Name | methyl (2S)-2-[(1S,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 93295589 |
| Molecular Formula | C21H18Cl2FNO3 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | methyl (2S)-2-[(1S,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
| SMILES | COC(=O)[C@H](c1ccccc1F)[C@@H]1C=C[C@@H](NC(=O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C21H18Cl2FNO3/c1-28-21(27)19(17-4-2-3-5-18(17)24)12-6-7-16(10-12)25-20(26)13-8-14(22)11-15(23)9-13/h2-9,11-12,16,19H,10H2,1H3,(H,25,26)/t12-,16-,19+/m1/s1 |
| InChIKey | KDCXYYAERMPRSU-FXHACXQTSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|