C28H25ClFNO3 — CID 93313875
methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1R,4S)-4-[(2,2-diphenylacetyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 93313875) has the molecular formula C28H25ClFNO3 and a molecular weight of 477.96 g/mol. Its IUPAC name is methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1R,4S)-4-[(2,2-diphenylacetyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1R,4S)-4-[(2,2-diphenylacetyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 93313875 |
| Molecular Formula | C28H25ClFNO3 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1R,4S)-4-[(2,2-diphenylacetyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccc(F)cc1Cl)[C@H]1C=C[C@@H](NC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H25ClFNO3/c1-34-28(33)26(23-15-13-21(30)17-24(23)29)20-12-14-22(16-20)31-27(32)25(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,17,20,22,25-26H,16H2,1H3,(H,31,32)/t20-,22+,26-/m0/s1 |
| InChIKey | KNWKNHCJMYZDLD-HXAGEGRHSA-N |
| XLogP | 5.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|