C22H21ClFNO4 — CID 92761001
methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1S,4R)-4-[(2-methoxybenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 92761001) has the molecular formula C22H21ClFNO4 and a molecular weight of 417.86 g/mol. Its IUPAC name is methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1S,4R)-4-[(2-methoxybenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1S,4R)-4-[(2-methoxybenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 92761001 |
| Molecular Formula | C22H21ClFNO4 |
| Molecular Weight | 417.86 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | methyl (2S)-2-(2-chloro-4-fluorophenyl)-2-[(1S,4R)-4-[(2-methoxybenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccc(F)cc1Cl)[C@@H]1C=C[C@H](NC(=O)c2ccccc2OC)C1 |
| InChI | InChI=1S/C22H21ClFNO4/c1-28-19-6-4-3-5-17(19)21(26)25-15-9-7-13(11-15)20(22(27)29-2)16-10-8-14(24)12-18(16)23/h3-10,12-13,15,20H,11H2,1-2H3,(H,25,26)/t13-,15+,20+/m1/s1 |
| InChIKey | SGDZHWQSGOJFFI-AFBRZQFHSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|