C26H31NO5 — CID 92761711
ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4R)-4-[(2,4-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 92761711) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4R)-4-[(2,4-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4R)-4-[(2,4-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 92761711 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4R)-4-[(2,4-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)[C@H](c1cc(OC)ccc1OC)[C@H]1C=C[C@H](NC(=O)c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C26H31NO5/c1-6-32-26(29)24(22-15-20(30-4)10-12-23(22)31-5)18-8-9-19(14-18)27-25(28)21-11-7-16(2)13-17(21)3/h7-13,15,18-19,24H,6,14H2,1-5H3,(H,27,28)/t18-,19-,24-/m0/s1 |
| InChIKey | SPUWELVAWZVXDJ-JXQFQVJHSA-N |
| XLogP | 4.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|