C26H31NO3 — CID 92760584
ethyl (2S)-2-[(1R,4R)-4-[(2,3-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,5-dimethylphenyl)acetate (PubChem CID 92760584) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl (2S)-2-[(1R,4R)-4-[(2,3-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,5-dimethylphenyl)acetate.
| Compound Name | ethyl (2S)-2-[(1R,4R)-4-[(2,3-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,5-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 92760584 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | ethyl (2S)-2-[(1R,4R)-4-[(2,3-dimethylbenzoyl)amino]cyclopent-2-en-1-yl]-2-(3,5-dimethylphenyl)acetate |
| SMILES | CCOC(=O)[C@H](c1cc(C)cc(C)c1)[C@H]1C=C[C@H](NC(=O)c2cccc(C)c2C)C1 |
| InChI | InChI=1S/C26H31NO3/c1-6-30-26(29)24(21-13-16(2)12-17(3)14-21)20-10-11-22(15-20)27-25(28)23-9-7-8-18(4)19(23)5/h7-14,20,22,24H,6,15H2,1-5H3,(H,27,28)/t20-,22-,24-/m0/s1 |
| InChIKey | XIZPJCODBIISTD-SSPYTLHUSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|