C25H29NO3 — CID 93293947
ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4S)-4-[(3-methylbenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 93293947) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4S)-4-[(3-methylbenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4S)-4-[(3-methylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 93293947 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl (2S)-2-(3,5-dimethylphenyl)-2-[(1S,4S)-4-[(3-methylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCOC(=O)[C@H](c1cc(C)cc(C)c1)[C@@H]1C=C[C@@H](NC(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C25H29NO3/c1-5-29-25(28)23(21-13-17(3)11-18(4)14-21)19-9-10-22(15-19)26-24(27)20-8-6-7-16(2)12-20/h6-14,19,22-23H,5,15H2,1-4H3,(H,26,27)/t19-,22-,23+/m1/s1 |
| InChIKey | ADCIKNKYIQAKTR-PTUXOGIPSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|