C29H37NO5 — CID 93299853
ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 93299853) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 93299853 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | ethyl (2S)-2-(2,5-dimethoxyphenyl)-2-[(1R,4S)-4-[(4-pentylbenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | CCCCCc1ccc(C(=O)N[C@@H]2C=C[C@H]([C@H](C(=O)OCC)c3cc(OC)ccc3OC)C2)cc1 |
| InChI | InChI=1S/C29H37NO5/c1-5-7-8-9-20-10-12-21(13-11-20)28(31)30-23-15-14-22(18-23)27(29(32)35-6-2)25-19-24(33-3)16-17-26(25)34-4/h10-17,19,22-23,27H,5-9,18H2,1-4H3,(H,30,31)/t22-,23+,27-/m0/s1 |
| InChIKey | FPVFMJHDTPWJDH-OBTVHEKISA-N |
| XLogP | 5.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|