C26H25F6NO5 — CID 46102375
ethyl 2-[4-[[2,6-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2,5-dimethoxyphenyl)acetate (PubChem CID 46102375) has the molecular formula C26H25F6NO5 and a molecular weight of 545.48 g/mol. Its IUPAC name is ethyl 2-[4-[[2,6-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2,5-dimethoxyphenyl)acetate.
| Compound Name | ethyl 2-[4-[[2,6-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2,5-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 46102375 |
| Molecular Formula | C26H25F6NO5 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | ethyl 2-[4-[[2,6-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2,5-dimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(c1cc(OC)ccc1OC)C1C=CC(NC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C26H25F6NO5/c1-4-38-24(35)21(17-13-16(36-2)10-11-20(17)37-3)14-8-9-15(12-14)33-23(34)22-18(25(27,28)29)6-5-7-19(22)26(30,31)32/h5-11,13-15,21H,4,12H2,1-3H3,(H,33,34) |
| InChIKey | RJQGVMCWIVEAQV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|