C23H18F7NO3 — CID 92767904
methyl (2S)-2-[(1S,4R)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate (PubChem CID 92767904) has the molecular formula C23H18F7NO3 and a molecular weight of 489.39 g/mol. Its IUPAC name is methyl (2S)-2-[(1S,4R)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate.
| Compound Name | methyl (2S)-2-[(1S,4R)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 92767904 |
| Molecular Formula | C23H18F7NO3 |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | methyl (2S)-2-[(1S,4R)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-(2-fluorophenyl)acetate |
| SMILES | COC(=O)[C@H](c1ccccc1F)[C@@H]1C=C[C@H](NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H18F7NO3/c1-34-21(33)19(17-4-2-3-5-18(17)24)12-6-7-16(10-12)31-20(32)13-8-14(22(25,26)27)11-15(9-13)23(28,29)30/h2-9,11-12,16,19H,10H2,1H3,(H,31,32)/t12-,16+,19+/m1/s1 |
| InChIKey | FODNEONSOZUCPZ-GFJSAUFNSA-N |
| XLogP | 5.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|