C21H35ClN4O4S — CID 46110376
3-chloro-N-[4-(diethylamino)-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 46110376) has the molecular formula C21H35ClN4O4S and a molecular weight of 475.06 g/mol. Its IUPAC name is 3-chloro-N-[4-(diethylamino)-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-(diethylamino)-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 46110376 |
| Molecular Formula | C21H35ClN4O4S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-chloro-N-[4-(diethylamino)-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)(C)CCl)cc1S(=O)(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H35ClN4O4S/c1-5-26(6-2)18-8-7-17(24-20(27)21(3,4)16-22)15-19(18)31(28,29)23-9-10-25-11-13-30-14-12-25/h7-8,15,23H,5-6,9-14,16H2,1-4H3,(H,24,27) |
| InChIKey | QFSDLYQVGGWKAA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|