C20H27N3O5S — CID 25048133
3-(diethylamino)-N-(2-morpholin-4-ylethyl)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25048133) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-(diethylamino)-N-(2-morpholin-4-ylethyl)-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | 3-(diethylamino)-N-(2-morpholin-4-ylethyl)-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25048133 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-(diethylamino)-N-(2-morpholin-4-ylethyl)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | CCN(CC)C1=C(S(=O)(=O)NCCN2CCOCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27N3O5S/c1-3-23(4-2)17-18(24)15-7-5-6-8-16(15)19(25)20(17)29(26,27)21-9-10-22-11-13-28-14-12-22/h5-8,21H,3-4,9-14H2,1-2H3 |
| InChIKey | BVTAMOLOGUIHDV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|