C28H40ClN5O5S — CID 46110398
3-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 46110398) has the molecular formula C28H40ClN5O5S and a molecular weight of 594.18 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 46110398 |
| Molecular Formula | C28H40ClN5O5S |
| Molecular Weight | 594.18 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 3-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylsulfamoyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)C(C)(C)CCl)cc2S(=O)(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C28H40ClN5O5S/c1-28(2,21-29)27(35)31-22-8-9-24(26(20-22)40(36,37)30-10-11-32-16-18-39-19-17-32)34-14-12-33(13-15-34)23-6-4-5-7-25(23)38-3/h4-9,20,30H,10-19,21H2,1-3H3,(H,31,35) |
| InChIKey | PPWHZSQROLXILF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|