C7H9NO3 — CID 46189441
(4R)-4-[(2R)-2,5-dihydrofuran-2-yl]-1,3-oxazolidin-2-one (PubChem CID 46189441) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is (4R)-4-[(2R)-2,5-dihydrofuran-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(2R)-2,5-dihydrofuran-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 46189441 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (4R)-4-[(2R)-2,5-dihydrofuran-2-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H]([C@H]2C=CCO2)CO1 |
| InChI | InChI=1S/C7H9NO3/c9-7-8-5(4-11-7)6-2-1-3-10-6/h1-2,5-6H,3-4H2,(H,8,9)/t5-,6-/m1/s1 |
| InChIKey | ZKTSOTBWNLURDZ-PHDIDXHHSA-N |
| XLogP | 0.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|