C24H31NO4Sn — CID 46192093
dibutyltin(2+);(2S)-2-[(4-methoxy-2-oxidophenyl)methylideneamino]-2-phenylacetate (PubChem CID 46192093) has the molecular formula C24H31NO4Sn and a molecular weight of 516.23 g/mol. Its IUPAC name is dibutyltin(2+);(2S)-2-[(4-methoxy-2-oxidophenyl)methylideneamino]-2-phenylacetate.
| Compound Name | dibutyltin(2+);(2S)-2-[(4-methoxy-2-oxidophenyl)methylideneamino]-2-phenylacetate |
|---|---|
| PubChem CID | 46192093 |
| Molecular Formula | C24H31NO4Sn |
| Molecular Weight | 516.23 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | dibutyltin(2+);(2S)-2-[(4-methoxy-2-oxidophenyl)methylideneamino]-2-phenylacetate |
| SMILES | CCCC[Sn+2]CCCC.COc1ccc(/C=N/[C@H](C(=O)[O-])c2ccccc2)c([O-])c1 |
| InChI | InChI=1S/C16H15NO4.2C4H9.Sn/c1-21-13-8-7-12(14(18)9-13)10-17-15(16(19)20)11-5-3-2-4-6-11;2*1-3-4-2;/h2-10,15,18H,1H3,(H,19,20);2*1,3-4H2,2H3;/q;;;+2/p-2/b17-10+;;;/t15-;;;/m0.../s1 |
| InChIKey | FBEHLGHIVOLXOM-DREWVHFQSA-L |
| XLogP | 3.81 |
| TPSA | 84.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|