C14H22N4O7 — CID 46192886
tert-butyl N-[2-[[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]amino]-2-oxoethyl]carbamate (PubChem CID 46192886) has the molecular formula C14H22N4O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 46192886 |
| Molecular Formula | C14H22N4O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl N-[2-[[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N[C@H]1CCC(=O)N(CC(=O)NO)C1=O |
| InChI | InChI=1S/C14H22N4O7/c1-14(2,3)25-13(23)15-6-9(19)16-8-4-5-11(21)18(12(8)22)7-10(20)17-24/h8,24H,4-7H2,1-3H3,(H,15,23)(H,16,19)(H,17,20)/t8-/m0/s1 |
| InChIKey | CAKTYZDHTXDXCH-QMMMGPOBSA-N |
| XLogP | -1.35 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|